C19H22ClN3OS — CID 55756311
N-[(5-chlorothiophen-2-yl)methyl]-2-piperidin-1-yl-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 55756311) has the molecular formula C19H22ClN3OS and a molecular weight of 375.93 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-piperidin-1-yl-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-piperidin-1-yl-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 55756311 |
| Molecular Formula | C19H22ClN3OS |
| Molecular Weight | 375.93 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-piperidin-1-yl-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)c1cccnc1N1CCCCC1 |
| InChI | InChI=1S/C19H22ClN3OS/c1-2-11-23(14-15-8-9-17(20)25-15)19(24)16-7-6-10-21-18(16)22-12-4-3-5-13-22/h2,6-10H,1,3-5,11-14H2 |
| InChIKey | WPESBJPJKJBXRK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|