C21H35N3O3S — CID 55769265
1-[2-methyl-1-[4-(2-methylpropyl)phenyl]propyl]-3-(1-methylsulfonylpiperidin-4-yl)urea (PubChem CID 55769265) has the molecular formula C21H35N3O3S and a molecular weight of 409.60 g/mol. Its IUPAC name is 1-[2-methyl-1-[4-(2-methylpropyl)phenyl]propyl]-3-(1-methylsulfonylpiperidin-4-yl)urea.
| Compound Name | 1-[2-methyl-1-[4-(2-methylpropyl)phenyl]propyl]-3-(1-methylsulfonylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 55769265 |
| Molecular Formula | C21H35N3O3S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 1-[2-methyl-1-[4-(2-methylpropyl)phenyl]propyl]-3-(1-methylsulfonylpiperidin-4-yl)urea |
| SMILES | CC(C)Cc1ccc(C(NC(=O)NC2CCN(S(C)(=O)=O)CC2)C(C)C)cc1 |
| InChI | InChI=1S/C21H35N3O3S/c1-15(2)14-17-6-8-18(9-7-17)20(16(3)4)23-21(25)22-19-10-12-24(13-11-19)28(5,26)27/h6-9,15-16,19-20H,10-14H2,1-5H3,(H2,22,23,25) |
| InChIKey | HIVLMTZDMHVVDT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |