C21H18FN3O3S — CID 55777745
N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-fluoro-4-methyl-5-nitrobenzamide (PubChem CID 55777745) has the molecular formula C21H18FN3O3S and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-fluoro-4-methyl-5-nitrobenzamide.
| Compound Name | N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-fluoro-4-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 55777745 |
| Molecular Formula | C21H18FN3O3S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-fluoro-4-methyl-5-nitrobenzamide |
| SMILES | Cc1c(F)cc(C(=O)Nc2ccccc2N2CCc3sccc3C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H18FN3O3S/c1-13-16(22)10-15(11-19(13)25(27)28)21(26)23-17-4-2-3-5-18(17)24-8-6-20-14(12-24)7-9-29-20/h2-5,7,9-11H,6,8,12H2,1H3,(H,23,26) |
| InChIKey | YAXUBWKLXPYFQI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|