C21H17F3N4O7 — CID 55782019
N-[4-[[2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide (PubChem CID 55782019) has the molecular formula C21H17F3N4O7 and a molecular weight of 494.38 g/mol. Its IUPAC name is N-[4-[[2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide.
| Compound Name | N-[4-[[2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 55782019 |
| Molecular Formula | C21H17F3N4O7 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | N-[4-[[2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Cn1c(=O)oc2cc([N+](=O)[O-])ccc21)Nc1ccc(NC(=O)C2CCCO2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H17F3N4O7/c22-21(23,24)13-8-11(25-19(30)16-2-1-7-34-16)3-5-14(13)26-18(29)10-27-15-6-4-12(28(32)33)9-17(15)35-20(27)31/h3-6,8-9,16H,1-2,7,10H2,(H,25,30)(H,26,29) |
| InChIKey | NQHMXLGSMHLJKL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|