C23H19N5O6 — CID 55783939
3-[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 55783939) has the molecular formula C23H19N5O6 and a molecular weight of 461.43 g/mol. Its IUPAC name is 3-[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 3-[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55783939 |
| Molecular Formula | C23H19N5O6 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 3-[[2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(CN1C(=O)COc2ccc([N+](=O)[O-])cc21)Nc1cccc(C(=O)NCc2ccccn2)c1 |
| InChI | InChI=1S/C23H19N5O6/c29-21(13-27-19-11-18(28(32)33)7-8-20(19)34-14-22(27)30)26-16-6-3-4-15(10-16)23(31)25-12-17-5-1-2-9-24-17/h1-11H,12-14H2,(H,25,31)(H,26,29) |
| InChIKey | FIUFYDBXLBFAMY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 143.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|