C18H20N4O4 — CID 55823124
2-methyl-N-[2-oxo-2-[4-(prop-2-enylcarbamoylamino)anilino]ethyl]furan-3-carboxamide (PubChem CID 55823124) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-methyl-N-[2-oxo-2-[4-(prop-2-enylcarbamoylamino)anilino]ethyl]furan-3-carboxamide.
| Compound Name | 2-methyl-N-[2-oxo-2-[4-(prop-2-enylcarbamoylamino)anilino]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 55823124 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-methyl-N-[2-oxo-2-[4-(prop-2-enylcarbamoylamino)anilino]ethyl]furan-3-carboxamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)CNC(=O)c2ccoc2C)cc1 |
| InChI | InChI=1S/C18H20N4O4/c1-3-9-19-18(25)22-14-6-4-13(5-7-14)21-16(23)11-20-17(24)15-8-10-26-12(15)2/h3-8,10H,1,9,11H2,2H3,(H,20,24)(H,21,23)(H2,19,22,25) |
| InChIKey | XIZIHTBPDCTLCD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|