C24H27N3O4S2 — CID 55842434
5-(azepan-1-ylsulfonyl)-2-methoxy-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]benzamide (PubChem CID 55842434) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-2-methoxy-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]benzamide.
| Compound Name | 5-(azepan-1-ylsulfonyl)-2-methoxy-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55842434 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-2-methoxy-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCCC2)cc1C(=O)NCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C24H27N3O4S2/c1-31-22-12-11-19(33(29,30)27-13-7-2-3-8-14-27)15-20(22)24(28)25-16-23-26-21(17-32-23)18-9-5-4-6-10-18/h4-6,9-12,15,17H,2-3,7-8,13-14,16H2,1H3,(H,25,28) |
| InChIKey | PZMQWWXBDOWRAU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |