C17H13ClN6O — CID 55870098
1-(3-chlorophenyl)-N-(1H-indazol-5-yl)-5-methyltriazole-4-carboxamide (PubChem CID 55870098) has the molecular formula C17H13ClN6O and a molecular weight of 352.79 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(1H-indazol-5-yl)-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-(1H-indazol-5-yl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 55870098 |
| Molecular Formula | C17H13ClN6O |
| Molecular Weight | 352.79 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(1H-indazol-5-yl)-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc3[nH]ncc3c2)nnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H13ClN6O/c1-10-16(22-23-24(10)14-4-2-3-12(18)8-14)17(25)20-13-5-6-15-11(7-13)9-19-21-15/h2-9H,1H3,(H,19,21)(H,20,25) |
| InChIKey | JQVIVNLZVIOEBC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.79 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |