C14H10ClFN6O2 — CID 91651550
1-(3-chlorophenyl)-N-(5-fluoro-2-oxo-1H-pyrimidin-6-yl)-5-methyltriazole-4-carboxamide (PubChem CID 91651550) has the molecular formula C14H10ClFN6O2 and a molecular weight of 348.73 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(5-fluoro-2-oxo-1H-pyrimidin-6-yl)-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-(5-fluoro-2-oxo-1H-pyrimidin-6-yl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 91651550 |
| Molecular Formula | C14H10ClFN6O2 |
| Molecular Weight | 348.73 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(5-fluoro-2-oxo-1H-pyrimidin-6-yl)-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2[nH]c(=O)ncc2F)nnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H10ClFN6O2/c1-7-11(13(23)18-12-10(16)6-17-14(24)19-12)20-21-22(7)9-4-2-3-8(15)5-9/h2-6H,1H3,(H2,17,18,19,23,24) |
| InChIKey | XVCHKWBNRJAQPM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.73 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |