C23H18FN3O4S — CID 55879090
N-[3-(3-cyanopropoxy)phenyl]-2-(2-fluorophenyl)sulfanyl-5-nitrobenzamide (PubChem CID 55879090) has the molecular formula C23H18FN3O4S and a molecular weight of 451.48 g/mol. Its IUPAC name is N-[3-(3-cyanopropoxy)phenyl]-2-(2-fluorophenyl)sulfanyl-5-nitrobenzamide.
| Compound Name | N-[3-(3-cyanopropoxy)phenyl]-2-(2-fluorophenyl)sulfanyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 55879090 |
| Molecular Formula | C23H18FN3O4S |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-[3-(3-cyanopropoxy)phenyl]-2-(2-fluorophenyl)sulfanyl-5-nitrobenzamide |
| SMILES | N#CCCCOc1cccc(NC(=O)c2cc([N+](=O)[O-])ccc2Sc2ccccc2F)c1 |
| InChI | InChI=1S/C23H18FN3O4S/c24-20-8-1-2-9-22(20)32-21-11-10-17(27(29)30)15-19(21)23(28)26-16-6-5-7-18(14-16)31-13-4-3-12-25/h1-2,5-11,14-15H,3-4,13H2,(H,26,28) |
| InChIKey | UDXDAVRVPFPAKD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|