C19H22ClN5O4 — CID 55898087
N-[3-(4-chlorophenoxy)propyl]-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-methylacetamide (PubChem CID 55898087) has the molecular formula C19H22ClN5O4 and a molecular weight of 419.87 g/mol. Its IUPAC name is N-[3-(4-chlorophenoxy)propyl]-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-methylacetamide.
| Compound Name | N-[3-(4-chlorophenoxy)propyl]-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 55898087 |
| Molecular Formula | C19H22ClN5O4 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[3-(4-chlorophenoxy)propyl]-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-methylacetamide |
| SMILES | CN(CCCOc1ccc(Cl)cc1)C(=O)Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C19H22ClN5O4/c1-22(9-4-10-29-14-7-5-13(20)6-8-14)15(26)11-25-18(27)16-17(21-12-23(16)2)24(3)19(25)28/h5-8,12H,4,9-11H2,1-3H3 |
| InChIKey | IGBHTHBLTCDADY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 91.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|