C20H21ClN4O4 — CID 55898353
N-[3-(4-chlorophenoxy)propyl]-N,1,3-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide (PubChem CID 55898353) has the molecular formula C20H21ClN4O4 and a molecular weight of 416.87 g/mol. Its IUPAC name is N-[3-(4-chlorophenoxy)propyl]-N,1,3-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N-[3-(4-chlorophenoxy)propyl]-N,1,3-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 55898353 |
| Molecular Formula | C20H21ClN4O4 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[3-(4-chlorophenoxy)propyl]-N,1,3-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(CCCOc1ccc(Cl)cc1)C(=O)c1ccc2c(=O)n(C)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C20H21ClN4O4/c1-23(11-4-12-29-14-7-5-13(21)6-8-14)19(27)16-10-9-15-17(22-16)24(2)20(28)25(3)18(15)26/h5-10H,4,11-12H2,1-3H3 |
| InChIKey | LLHXTPPJEOAMJV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|