C25H22N4O4S — CID 55914668
N'-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxobutanoyl]-2-(furan-2-yl)quinoline-4-carbohydrazide (PubChem CID 55914668) has the molecular formula C25H22N4O4S and a molecular weight of 474.54 g/mol. Its IUPAC name is N'-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxobutanoyl]-2-(furan-2-yl)quinoline-4-carbohydrazide.
| Compound Name | N'-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxobutanoyl]-2-(furan-2-yl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 55914668 |
| Molecular Formula | C25H22N4O4S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N'-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxobutanoyl]-2-(furan-2-yl)quinoline-4-carbohydrazide |
| SMILES | O=C(CCC(=O)N1CCc2sccc2C1)NNC(=O)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C25H22N4O4S/c30-23(7-8-24(31)29-11-9-22-16(15-29)10-13-34-22)27-28-25(32)18-14-20(21-6-3-12-33-21)26-19-5-2-1-4-17(18)19/h1-6,10,12-14H,7-9,11,15H2,(H,27,30)(H,28,32) |
| InChIKey | HEBSQCNKGFQRQL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|