C26H27FN4O3S — CID 55918138
N-(2-fluorophenyl)-N-[4-[(E)-3-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 55918138) has the molecular formula C26H27FN4O3S and a molecular weight of 494.59 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N-[4-[(E)-3-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-N-[4-[(E)-3-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 55918138 |
| Molecular Formula | C26H27FN4O3S |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | N-(2-fluorophenyl)-N-[4-[(E)-3-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc(N2CCCN(C(=O)/C=C/c3csc(N(C(C)=O)c4ccccc4F)n3)CC2)cc1 |
| InChI | InChI=1S/C26H27FN4O3S/c1-19(32)31(24-7-4-3-6-23(24)27)26-28-20(18-35-26)8-13-25(33)30-15-5-14-29(16-17-30)21-9-11-22(34-2)12-10-21/h3-4,6-13,18H,5,14-17H2,1-2H3/b13-8+ |
| InChIKey | UPFYTTUDRDLQAX-MDWZMJQESA-N |
| XLogP | 4.73 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|