C19H23FN2O4S — CID 55919608
5-(tert-butylsulfamoyl)-N-[(2-fluorophenyl)methyl]-N-prop-2-enylfuran-2-carboxamide (PubChem CID 55919608) has the molecular formula C19H23FN2O4S and a molecular weight of 394.47 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-[(2-fluorophenyl)methyl]-N-prop-2-enylfuran-2-carboxamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-[(2-fluorophenyl)methyl]-N-prop-2-enylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55919608 |
| Molecular Formula | C19H23FN2O4S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-[(2-fluorophenyl)methyl]-N-prop-2-enylfuran-2-carboxamide |
| SMILES | C=CCN(Cc1ccccc1F)C(=O)c1ccc(S(=O)(=O)NC(C)(C)C)o1 |
| InChI | InChI=1S/C19H23FN2O4S/c1-5-12-22(13-14-8-6-7-9-15(14)20)18(23)16-10-11-17(26-16)27(24,25)21-19(2,3)4/h5-11,21H,1,12-13H2,2-4H3 |
| InChIKey | SRSPIGYUKLRFIU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|