C23H26N4O3S — CID 55958214
3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[3-(2-methylimidazol-1-yl)propyl]benzamide (PubChem CID 55958214) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[3-(2-methylimidazol-1-yl)propyl]benzamide.
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[3-(2-methylimidazol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 55958214 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[3-(2-methylimidazol-1-yl)propyl]benzamide |
| SMILES | Cc1nccn1CCCNC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C23H26N4O3S/c1-18-24-12-15-26(18)13-5-11-25-23(28)20-8-4-9-22(16-20)31(29,30)27-14-10-19-6-2-3-7-21(19)17-27/h2-4,6-9,12,15-16H,5,10-11,13-14,17H2,1H3,(H,25,28) |
| InChIKey | ZEBVSZVZIDBNFI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|