C19H28F3N3O4 — CID 55962113
3-methoxy-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide (PubChem CID 55962113) has the molecular formula C19H28F3N3O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 3-methoxy-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide.
| Compound Name | 3-methoxy-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 55962113 |
| Molecular Formula | C19H28F3N3O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 3-methoxy-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide |
| SMILES | COc1cc(C(=O)NCCCN(C)CC(F)(F)F)ccc1OCC(=O)NC(C)C |
| InChI | InChI=1S/C19H28F3N3O4/c1-13(2)24-17(26)11-29-15-7-6-14(10-16(15)28-4)18(27)23-8-5-9-25(3)12-19(20,21)22/h6-7,10,13H,5,8-9,11-12H2,1-4H3,(H,23,27)(H,24,26) |
| InChIKey | GDJGAXDJOLYTCU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|