C23H40O4 — CID 559817
2-(hydroxymethyl)-6-[4-(4-pentylcyclohexyl)cyclohexyl]oxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 559817) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[4-(4-pentylcyclohexyl)cyclohexyl]oxy-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | 2-(hydroxymethyl)-6-[4-(4-pentylcyclohexyl)cyclohexyl]oxy-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 559817 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 2-(hydroxymethyl)-6-[4-(4-pentylcyclohexyl)cyclohexyl]oxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CCCCCC1CCC(C2CCC(OC3C=CC(O)C(CO)O3)CC2)CC1 |
| InChI | InChI=1S/C23H40O4/c1-2-3-4-5-17-6-8-18(9-7-17)19-10-12-20(13-11-19)26-23-15-14-21(25)22(16-24)27-23/h14-15,17-25H,2-13,16H2,1H3 |
| InChIKey | CMEMTHZGFGDXOM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|