C24H24Cl3N3 — CID 561265
N'-benzyl-N-[1-(benzylamino)-2,2,2-trichloroethyl]-4-methylbenzenecarboximidamide (PubChem CID 561265) has the molecular formula C24H24Cl3N3 and a molecular weight of 460.84 g/mol. Its IUPAC name is N'-benzyl-N-[1-(benzylamino)-2,2,2-trichloroethyl]-4-methylbenzenecarboximidamide.
| Compound Name | N'-benzyl-N-[1-(benzylamino)-2,2,2-trichloroethyl]-4-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 561265 |
| Molecular Formula | C24H24Cl3N3 |
| Molecular Weight | 460.84 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | N'-benzyl-N-[1-(benzylamino)-2,2,2-trichloroethyl]-4-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(/C(=N\Cc2ccccc2)NC(NCc2ccccc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C24H24Cl3N3/c1-18-12-14-21(15-13-18)22(28-16-19-8-4-2-5-9-19)30-23(24(25,26)27)29-17-20-10-6-3-7-11-20/h2-15,23,29H,16-17H2,1H3,(H,28,30) |
| InChIKey | LWPWZMIJWLSRLL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.84 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|