About N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene
N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene (PubChem CID 143534895) has the molecular formula C25H25ClN2O
and a molecular weight of 404.94 g/mol. Its IUPAC name is N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene.
Molecular Properties
| Compound Name | N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene |
| PubChem CID | 143534895 |
| Molecular Formula | C25H25ClN2O |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene |
| SMILES | C=C(/C(=N/Cc1ccccc1)NC(C)=O)c1ccccc1.Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18N2O.C7H7Cl/c1-14(17-11-7-4-8-12-17)18(20-15(2)21)19-13-16-9-5-3-6-10-16;1-6-2-4-7(8)5-3-6/h3-12H,1,13H2,2H3,(H,19,20,21);2-5H,1H3 |
| InChIKey | JBGIZEXADVROCQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene?
The IUPAC name of N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene (CID 143534895) is N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene.
What is the SMILES notation for N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene?
The canonical SMILES for N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene is C=C(/C(=N/Cc1ccccc1)NC(C)=O)c1ccccc1.Cc1ccc(Cl)cc1.
What is the InChIKey of N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene?
The InChIKey is JBGIZEXADVROCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O.C7H7Cl/c1-14(17-11-7-4-8-12-17)18(20-15(2)21)19-13-16-9-5-3-6-10-16;1-6-2-4-7(8)5-3-6/h3-12H,1,13H2,2H3,(H,19,20,21);2-5H,1H3.
What are the key properties of N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene?
N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene has a molecular weight of 404.94 g/mol, XLogP of 6.08, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene is sourced from PubChem (CID 143534895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).