C25H25ClN2O — CID 143534895
N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene (PubChem CID 143534895) has the molecular formula C25H25ClN2O and a molecular weight of 404.94 g/mol. Its IUPAC name is N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene.
| Compound Name | N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene |
|---|---|
| PubChem CID | 143534895 |
| Molecular Formula | C25H25ClN2O |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[N-benzyl-C-(1-phenylethenyl)carbonimidoyl]acetamide;1-chloro-4-methylbenzene |
| SMILES | C=C(/C(=N/Cc1ccccc1)NC(C)=O)c1ccccc1.Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18N2O.C7H7Cl/c1-14(17-11-7-4-8-12-17)18(20-15(2)21)19-13-16-9-5-3-6-10-16;1-6-2-4-7(8)5-3-6/h3-12H,1,13H2,2H3,(H,19,20,21);2-5H,1H3 |
| InChIKey | JBGIZEXADVROCQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|