C24H18N4O3S — CID 56508477
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 56508477) has the molecular formula C24H18N4O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 56508477 |
| Molecular Formula | C24H18N4O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1nc(C)c2c(C)c(C(=O)Nc3cccc(N4C(=O)c5ccccc5C4=O)c3)sc2n1 |
| InChI | InChI=1S/C24H18N4O3S/c1-12-19-13(2)25-14(3)26-22(19)32-20(12)21(29)27-15-7-6-8-16(11-15)28-23(30)17-9-4-5-10-18(17)24(28)31/h4-11H,1-3H3,(H,27,29) |
| InChIKey | WXTUIGDLTXLAGM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|