C21H20N4O6 — CID 56523119
methyl 5-morpholin-4-yl-2-[(5-nitro-1H-indole-3-carbonyl)amino]benzoate (PubChem CID 56523119) has the molecular formula C21H20N4O6 and a molecular weight of 424.41 g/mol. Its IUPAC name is methyl 5-morpholin-4-yl-2-[(5-nitro-1H-indole-3-carbonyl)amino]benzoate.
| Compound Name | methyl 5-morpholin-4-yl-2-[(5-nitro-1H-indole-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 56523119 |
| Molecular Formula | C21H20N4O6 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | methyl 5-morpholin-4-yl-2-[(5-nitro-1H-indole-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)c1c[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C21H20N4O6/c1-30-21(27)16-10-13(24-6-8-31-9-7-24)2-5-19(16)23-20(26)17-12-22-18-4-3-14(25(28)29)11-15(17)18/h2-5,10-12,22H,6-9H2,1H3,(H,23,26) |
| InChIKey | QHSWGNGUNFRQQW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|