C20H25F3N4O2S — CID 56529445
2,2,2-trifluoroethyl N-[2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]carbamate (PubChem CID 56529445) has the molecular formula C20H25F3N4O2S and a molecular weight of 442.51 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 56529445 |
| Molecular Formula | C20H25F3N4O2S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]carbamate |
| SMILES | C=CCn1c(SCCNC(=O)OCC(F)(F)F)nnc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H25F3N4O2S/c1-5-11-27-16(14-6-8-15(9-7-14)19(2,3)4)25-26-17(27)30-12-10-24-18(28)29-13-20(21,22)23/h5-9H,1,10-13H2,2-4H3,(H,24,28) |
| InChIKey | BOYXETBISQIEKX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|