C20H35N3O — CID 56542859
2-[(2-tert-butylcyclohexyl)amino]-N-(1-cyanocycloheptyl)acetamide (PubChem CID 56542859) has the molecular formula C20H35N3O and a molecular weight of 333.52 g/mol. Its IUPAC name is 2-[(2-tert-butylcyclohexyl)amino]-N-(1-cyanocycloheptyl)acetamide.
| Compound Name | 2-[(2-tert-butylcyclohexyl)amino]-N-(1-cyanocycloheptyl)acetamide |
|---|---|
| PubChem CID | 56542859 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | 2-[(2-tert-butylcyclohexyl)amino]-N-(1-cyanocycloheptyl)acetamide |
| SMILES | CC(C)(C)C1CCCCC1NCC(=O)NC1(C#N)CCCCCC1 |
| InChI | InChI=1S/C20H35N3O/c1-19(2,3)16-10-6-7-11-17(16)22-14-18(24)23-20(15-21)12-8-4-5-9-13-20/h16-17,22H,4-14H2,1-3H3,(H,23,24) |
| InChIKey | NQKOZOOXILUDNE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |