C24H24N6O2 — CID 56547468
(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]prop-2-enamide (PubChem CID 56547468) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 56547468 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)propan-2-yl]prop-2-enamide |
| SMILES | Cc1nc(C(C)(C)NC(=O)/C=C/c2cn(Cc3ccccc3)nc2-c2cccnc2)no1 |
| InChI | InChI=1S/C24H24N6O2/c1-17-26-23(29-32-17)24(2,3)27-21(31)12-11-20-16-30(15-18-8-5-4-6-9-18)28-22(20)19-10-7-13-25-14-19/h4-14,16H,15H2,1-3H3,(H,27,31)/b12-11+ |
| InChIKey | RCNUFWDRGDIYFG-VAWYXSNFSA-N |
| XLogP | 3.75 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|