C19H26BrN3O3 — CID 56547786
1-[3-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 56547786) has the molecular formula C19H26BrN3O3 and a molecular weight of 424.34 g/mol. Its IUPAC name is 1-[3-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56547786 |
| Molecular Formula | C19H26BrN3O3 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 1-[3-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)NCCCN1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C19H26BrN3O3/c1-26-17-7-6-16(20)12-14(17)5-8-18(24)22-9-3-11-23-10-2-4-15(13-23)19(21)25/h5-8,12,15H,2-4,9-11,13H2,1H3,(H2,21,25)(H,22,24)/b8-5+ |
| InChIKey | LOYRLBDLTSTHGO-VMPITWQZSA-N |
| XLogP | 2.17 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|