C20H24F3N3O — CID 56552750
N-[4-(N-methylanilino)butyl]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 56552750) has the molecular formula C20H24F3N3O and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[4-(N-methylanilino)butyl]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[4-(N-methylanilino)butyl]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 56552750 |
| Molecular Formula | C20H24F3N3O |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[4-(N-methylanilino)butyl]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | CN(CCCCNC(=O)CNc1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C20H24F3N3O/c1-26(18-10-3-2-4-11-18)13-6-5-12-24-19(27)15-25-17-9-7-8-16(14-17)20(21,22)23/h2-4,7-11,14,25H,5-6,12-13,15H2,1H3,(H,24,27) |
| InChIKey | DGXQNINPZYLXFS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|