C20H21F3N4O3 — CID 56562776
7,7-dimethyl-2,5-dioxo-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-6,8-dihydro-1H-quinoline-3-carboxamide (PubChem CID 56562776) has the molecular formula C20H21F3N4O3 and a molecular weight of 422.41 g/mol. Its IUPAC name is 7,7-dimethyl-2,5-dioxo-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-6,8-dihydro-1H-quinoline-3-carboxamide.
| Compound Name | 7,7-dimethyl-2,5-dioxo-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-6,8-dihydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 56562776 |
| Molecular Formula | C20H21F3N4O3 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 7,7-dimethyl-2,5-dioxo-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-6,8-dihydro-1H-quinoline-3-carboxamide |
| SMILES | CC1(C)CC(=O)c2cc(C(=O)NCCNc3ncccc3C(F)(F)F)c(=O)[nH]c2C1 |
| InChI | InChI=1S/C20H21F3N4O3/c1-19(2)9-14-11(15(28)10-19)8-12(18(30)27-14)17(29)26-7-6-25-16-13(20(21,22)23)4-3-5-24-16/h3-5,8H,6-7,9-10H2,1-2H3,(H,24,25)(H,26,29)(H,27,30) |
| InChIKey | GBVOUPLUQCHLCK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|