About tricyclohexylborane
tricyclohexylborane (PubChem CID 565757) has the molecular formula C18H33B
and a molecular weight of 260.27 g/mol. Its IUPAC name is tricyclohexylborane.
Molecular Properties
| Compound Name | tricyclohexylborane |
| PubChem CID | 565757 |
| Molecular Formula | C18H33B |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.27 |
| IUPAC Name | tricyclohexylborane |
| SMILES | C1CCC(B(C2CCCCC2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H33B/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h16-18H,1-15H2 |
| InChIKey | SJXLNIDKIYXLBL-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tricyclohexylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclohexylborane?
The IUPAC name of tricyclohexylborane (CID 565757) is tricyclohexylborane.
What is the SMILES notation for tricyclohexylborane?
The canonical SMILES for tricyclohexylborane is C1CCC(B(C2CCCCC2)C2CCCCC2)CC1.
What is the InChIKey of tricyclohexylborane?
The InChIKey is SJXLNIDKIYXLBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33B/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h16-18H,1-15H2.
What are the key properties of tricyclohexylborane?
tricyclohexylborane has a molecular weight of 260.27 g/mol, XLogP of 6.48, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclohexylborane is sourced from PubChem (CID 565757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).