C19H17F2N5O3S — CID 56576043
4-[(3,5-difluorobenzoyl)amino]-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-hydroxybenzamide (PubChem CID 56576043) has the molecular formula C19H17F2N5O3S and a molecular weight of 433.44 g/mol. Its IUPAC name is 4-[(3,5-difluorobenzoyl)amino]-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-hydroxybenzamide.
| Compound Name | 4-[(3,5-difluorobenzoyl)amino]-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 56576043 |
| Molecular Formula | C19H17F2N5O3S |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 4-[(3,5-difluorobenzoyl)amino]-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-hydroxybenzamide |
| SMILES | CCn1c(CNC(=O)c2ccc(NC(=O)c3cc(F)cc(F)c3)cc2O)n[nH]c1=S |
| InChI | InChI=1S/C19H17F2N5O3S/c1-2-26-16(24-25-19(26)30)9-22-18(29)14-4-3-13(8-15(14)27)23-17(28)10-5-11(20)7-12(21)6-10/h3-8,27H,2,9H2,1H3,(H,22,29)(H,23,28)(H,25,30) |
| InChIKey | MUZKNTLVLCOVAH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|