C15H17BrN4O4S — CID 56583515
N-(5-bromo-2-ethoxyphenyl)sulfonyl-6-(dimethylamino)pyridazine-3-carboxamide (PubChem CID 56583515) has the molecular formula C15H17BrN4O4S and a molecular weight of 429.30 g/mol. Its IUPAC name is N-(5-bromo-2-ethoxyphenyl)sulfonyl-6-(dimethylamino)pyridazine-3-carboxamide.
| Compound Name | N-(5-bromo-2-ethoxyphenyl)sulfonyl-6-(dimethylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 56583515 |
| Molecular Formula | C15H17BrN4O4S |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | N-(5-bromo-2-ethoxyphenyl)sulfonyl-6-(dimethylamino)pyridazine-3-carboxamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NC(=O)c1ccc(N(C)C)nn1 |
| InChI | InChI=1S/C15H17BrN4O4S/c1-4-24-12-7-5-10(16)9-13(12)25(22,23)19-15(21)11-6-8-14(18-17-11)20(2)3/h5-9H,4H2,1-3H3,(H,19,21) |
| InChIKey | RWZLEQZZNPLUSV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |