C28H30N4O3 — CID 56593952
N-(1,3-benzodioxol-4-ylmethyl)-N'-[7-[3-(dimethylamino)phenoxy]quinolin-4-yl]propane-1,3-diamine (PubChem CID 56593952) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-N'-[7-[3-(dimethylamino)phenoxy]quinolin-4-yl]propane-1,3-diamine.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-N'-[7-[3-(dimethylamino)phenoxy]quinolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 56593952 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-N'-[7-[3-(dimethylamino)phenoxy]quinolin-4-yl]propane-1,3-diamine |
| SMILES | CN(C)c1cccc(Oc2ccc3c(NCCCNCc4cccc5c4OCO5)ccnc3c2)c1 |
| InChI | InChI=1S/C28H30N4O3/c1-32(2)21-7-4-8-22(16-21)35-23-10-11-24-25(12-15-31-26(24)17-23)30-14-5-13-29-18-20-6-3-9-27-28(20)34-19-33-27/h3-4,6-12,15-17,29H,5,13-14,18-19H2,1-2H3,(H,30,31) |
| InChIKey | KXQHTTDFACASBM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 67.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|