C9H12O4 — CID 56601441
[(1R,2S,6R)-4-methyl-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl] acetate (PubChem CID 56601441) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is [(1R,2S,6R)-4-methyl-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl] acetate.
| Compound Name | [(1R,2S,6R)-4-methyl-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl] acetate |
|---|---|
| PubChem CID | 56601441 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | [(1R,2S,6R)-4-methyl-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC(C)C(=O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C9H12O4/c1-4-3-6(12-5(2)10)8-9(13-8)7(4)11/h4,6,8-9H,3H2,1-2H3/t4?,6-,8+,9-/m0/s1 |
| InChIKey | BFHIWGJNHQNSGT-VISDRYQZSA-N |
| XLogP | 0.29 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|