C6H9N5O3 — CID 56604069
6-hydrazinyl-4-hydroxy-2-oxo-1H-pyridine-3-carbohydrazide (PubChem CID 56604069) has the molecular formula C6H9N5O3 and a molecular weight of 199.17 g/mol. Its IUPAC name is 6-hydrazinyl-4-hydroxy-2-oxo-1H-pyridine-3-carbohydrazide.
| Compound Name | 6-hydrazinyl-4-hydroxy-2-oxo-1H-pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 56604069 |
| Molecular Formula | C6H9N5O3 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 6-hydrazinyl-4-hydroxy-2-oxo-1H-pyridine-3-carbohydrazide |
| SMILES | NNC(=O)c1c(O)cc(NN)[nH]c1=O |
| InChI | InChI=1S/C6H9N5O3/c7-10-3-1-2(12)4(5(13)9-3)6(14)11-8/h1H,7-8H2,(H,11,14)(H3,9,10,12,13) |
| InChIKey | LPGBSOUYKQDXIQ-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 146.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|