C15H16N2O5S — CID 56608834
2-[1-[(4-nitrophenyl)methoxycarbonyl]piperidin-2-ylidene]ethanethioic S-acid (PubChem CID 56608834) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-[1-[(4-nitrophenyl)methoxycarbonyl]piperidin-2-ylidene]ethanethioic S-acid.
| Compound Name | 2-[1-[(4-nitrophenyl)methoxycarbonyl]piperidin-2-ylidene]ethanethioic S-acid |
|---|---|
| PubChem CID | 56608834 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[1-[(4-nitrophenyl)methoxycarbonyl]piperidin-2-ylidene]ethanethioic S-acid |
| SMILES | O=C(S)C=C1CCCCN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H16N2O5S/c18-14(23)9-13-3-1-2-8-16(13)15(19)22-10-11-4-6-12(7-5-11)17(20)21/h4-7,9H,1-3,8,10H2,(H,18,23) |
| InChIKey | PUDWZHANTNXVIT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|