C27H31BrO5 — CID 56621150
[(1'S,2'R,3'aR,6'aS)-1'-(2-bromo-4,4-dimethyl-3-oxooct-1-en-6-ynyl)spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl] benzoate (PubChem CID 56621150) has the molecular formula C27H31BrO5 and a molecular weight of 515.44 g/mol. Its IUPAC name is [(1'S,2'R,3'aR,6'aS)-1'-(2-bromo-4,4-dimethyl-3-oxooct-1-en-6-ynyl)spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl] benzoate.
| Compound Name | [(1'S,2'R,3'aR,6'aS)-1'-(2-bromo-4,4-dimethyl-3-oxooct-1-en-6-ynyl)spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl] benzoate |
|---|---|
| PubChem CID | 56621150 |
| Molecular Formula | C27H31BrO5 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | [(1'S,2'R,3'aR,6'aS)-1'-(2-bromo-4,4-dimethyl-3-oxooct-1-en-6-ynyl)spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl] benzoate |
| SMILES | CC#CCC(C)(C)C(=O)C(Br)=C[C@@H]1[C@H]2CC3(C[C@H]2C[C@H]1OC(=O)c1ccccc1)OCCO3 |
| InChI | InChI=1S/C27H31BrO5/c1-4-5-11-26(2,3)24(29)22(28)15-20-21-17-27(31-12-13-32-27)16-19(21)14-23(20)33-25(30)18-9-7-6-8-10-18/h6-10,15,19-21,23H,11-14,16-17H2,1-3H3/t19-,20-,21+,23-/m1/s1 |
| InChIKey | KXUPLLNPRDDVGO-CUDBPUKSSA-N |
| XLogP | 5.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|