C30H37BrO5 — CID 123898892
[1'-(2-bromo-4-methyl-3-oxonon-1-en-6-ynyl)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl] benzoate (PubChem CID 123898892) has the molecular formula C30H37BrO5 and a molecular weight of 557.53 g/mol. Its IUPAC name is [1'-(2-bromo-4-methyl-3-oxonon-1-en-6-ynyl)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl] benzoate.
| Compound Name | [1'-(2-bromo-4-methyl-3-oxonon-1-en-6-ynyl)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl] benzoate |
|---|---|
| PubChem CID | 123898892 |
| Molecular Formula | C30H37BrO5 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | [1'-(2-bromo-4-methyl-3-oxonon-1-en-6-ynyl)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl] benzoate |
| SMILES | CCC#CCC(C)C(=O)C(Br)=CC1C(OC(=O)c2ccccc2)CC2CC3(CC21)OCC(C)(C)CO3 |
| InChI | InChI=1S/C30H37BrO5/c1-5-6-8-11-20(2)27(32)25(31)15-23-24-17-30(34-18-29(3,4)19-35-30)16-22(24)14-26(23)36-28(33)21-12-9-7-10-13-21/h7,9-10,12-13,15,20,22-24,26H,5,11,14,16-19H2,1-4H3 |
| InChIKey | JKUHHLXGEYNERB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|