C21H15NO4 — CID 56625040
3-ethyl-2-(4-methoxyphenyl)-11-oxa-14-azatetracyclo[6.5.1.04,14.09,13]tetradeca-1,3,5,7,9(13)-pentaene-10,12-dione (PubChem CID 56625040) has the molecular formula C21H15NO4 and a molecular weight of 345.35 g/mol. Its IUPAC name is 3-ethyl-2-(4-methoxyphenyl)-11-oxa-14-azatetracyclo[6.5.1.04,14.09,13]tetradeca-1,3,5,7,9(13)-pentaene-10,12-dione.
| Compound Name | 3-ethyl-2-(4-methoxyphenyl)-11-oxa-14-azatetracyclo[6.5.1.04,14.09,13]tetradeca-1,3,5,7,9(13)-pentaene-10,12-dione |
|---|---|
| PubChem CID | 56625040 |
| Molecular Formula | C21H15NO4 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-ethyl-2-(4-methoxyphenyl)-11-oxa-14-azatetracyclo[6.5.1.04,14.09,13]tetradeca-1,3,5,7,9(13)-pentaene-10,12-dione |
| SMILES | CCc1c(-c2ccc(OC)cc2)c2c3c(c4cccc1n42)C(=O)OC3=O |
| InChI | InChI=1S/C21H15NO4/c1-3-13-14-5-4-6-15-17-18(21(24)26-20(17)23)19(22(14)15)16(13)11-7-9-12(25-2)10-8-11/h4-10H,3H2,1-2H3 |
| InChIKey | JONWSGVSZYMUQI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|