C17H17NO3S — CID 56629536
2-methoxy-4-(3-nitroso-4-phenylsulfanylbut-1-enyl)phenol (PubChem CID 56629536) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-methoxy-4-(3-nitroso-4-phenylsulfanylbut-1-enyl)phenol.
| Compound Name | 2-methoxy-4-(3-nitroso-4-phenylsulfanylbut-1-enyl)phenol |
|---|---|
| PubChem CID | 56629536 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-methoxy-4-(3-nitroso-4-phenylsulfanylbut-1-enyl)phenol |
| SMILES | COc1cc(C=CC(CSc2ccccc2)N=O)ccc1O |
| InChI | InChI=1S/C17H17NO3S/c1-21-17-11-13(8-10-16(17)19)7-9-14(18-20)12-22-15-5-3-2-4-6-15/h2-11,14,19H,12H2,1H3 |
| InChIKey | FAVNWLTVOOUFSG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |