C9H14ClNO2 — CID 56632768
4-chloro-5,5-dimethoxy-4-methylcyclohex-2-en-1-imine (PubChem CID 56632768) has the molecular formula C9H14ClNO2 and a molecular weight of 203.67 g/mol. Its IUPAC name is 4-chloro-5,5-dimethoxy-4-methylcyclohex-2-en-1-imine.
| Compound Name | 4-chloro-5,5-dimethoxy-4-methylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 56632768 |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 4-chloro-5,5-dimethoxy-4-methylcyclohex-2-en-1-imine |
| SMILES | [H]/N=C1\C=CC(C)(Cl)C(OC)(OC)C1 |
| InChI | InChI=1S/C9H14ClNO2/c1-8(10)5-4-7(11)6-9(8,12-2)13-3/h4-5,11H,6H2,1-3H3/b11-7+ |
| InChIKey | XZDHEOLHEJKBNF-YRNVUSSQSA-N |
| XLogP | 1.95 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|