C21H21NO3S — CID 56635208
ethyl 2-[(6-methyl-4-oxo-2-phenyl-2,3-dihydrothiochromen-3-yl)methylideneamino]acetate (PubChem CID 56635208) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is ethyl 2-[(6-methyl-4-oxo-2-phenyl-2,3-dihydrothiochromen-3-yl)methylideneamino]acetate.
| Compound Name | ethyl 2-[(6-methyl-4-oxo-2-phenyl-2,3-dihydrothiochromen-3-yl)methylideneamino]acetate |
|---|---|
| PubChem CID | 56635208 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | ethyl 2-[(6-methyl-4-oxo-2-phenyl-2,3-dihydrothiochromen-3-yl)methylideneamino]acetate |
| SMILES | CCOC(=O)C/N=C/C1C(=O)c2cc(C)ccc2SC1c1ccccc1 |
| InChI | InChI=1S/C21H21NO3S/c1-3-25-19(23)13-22-12-17-20(24)16-11-14(2)9-10-18(16)26-21(17)15-7-5-4-6-8-15/h4-12,17,21H,3,13H2,1-2H3/b22-12+ |
| InChIKey | CDWXKVQLMYEYBI-WSDLNYQXSA-N |
| XLogP | 4.27 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|