C24H30F2N6O — CID 56647648
6-[3-(dimethylamino)propoxy]-2-N,4-N-bis[2-(4-fluorophenyl)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 56647648) has the molecular formula C24H30F2N6O and a molecular weight of 456.50 g/mol. Its IUPAC name is 6-[3-(dimethylamino)propoxy]-2-N,4-N-bis[2-(4-fluorophenyl)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[3-(dimethylamino)propoxy]-2-N,4-N-bis[2-(4-fluorophenyl)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 56647648 |
| Molecular Formula | C24H30F2N6O |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 6-[3-(dimethylamino)propoxy]-2-N,4-N-bis[2-(4-fluorophenyl)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)CCCOC1=NC(=NC(=N1)NCCC2=CC=C(C=C2)F)NCCC3=CC=C(C=C3)F |
| InChI | InChI=1S/C24H30F2N6O/c1-32(2)16-3-17-33-24-30-22(27-14-12-18-4-8-20(25)9-5-18)29-23(31-24)28-15-13-19-6-10-21(26)11-7-19/h4-11H,3,12-17H2,1-2H3,(H2,27,28,29,30,31) |
| InChIKey | WCTROQPDITWKTC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | 479 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|