C27H42N2O5S — CID 56654798
(3S,11S,16R)-4-deuterio-7,11-dideuteriooxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 56654798) has the molecular formula C27H42N2O5S and a molecular weight of 509.73 g/mol. Its IUPAC name is (3S,11S,16R)-4-deuterio-7,11-dideuteriooxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,11S,16R)-4-deuterio-7,11-dideuteriooxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 56654798 |
| Molecular Formula | C27H42N2O5S |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | (3S,11S,16R)-4-deuterio-7,11-dideuteriooxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | [2H]OC1CC(=O)N([2H])[C@H](/C(C)=C/c2csc(C)n2)CC2O[C@]2(C)CCCC(C)[C@H](O[2H])C(C)C(=O)C1(C)C |
| InChI | InChI=1S/C27H42N2O5S/c1-15-9-8-10-27(7)22(34-27)12-20(16(2)11-19-14-35-18(4)28-19)29-23(31)13-21(30)26(5,6)25(33)17(3)24(15)32/h11,14-15,17,20-22,24,30,32H,8-10,12-13H2,1-7H3,(H,29,31)/b16-11+/t15?,17?,20-,21?,22?,24-,27+/m0/s1/i30D,32D/hD |
| InChIKey | FABUFPQFXZVHFB-FBTMZLIXSA-N |
| XLogP | 4.05 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|