C19H16N2O8 — CID 56655292
[(Z,4R)-1-methoxy-5-nitro-4-(3-nitrophenyl)-1-oxopent-2-en-2-yl] benzoate (PubChem CID 56655292) has the molecular formula C19H16N2O8 and a molecular weight of 400.34 g/mol. Its IUPAC name is [(Z,4R)-1-methoxy-5-nitro-4-(3-nitrophenyl)-1-oxopent-2-en-2-yl] benzoate.
| Compound Name | [(Z,4R)-1-methoxy-5-nitro-4-(3-nitrophenyl)-1-oxopent-2-en-2-yl] benzoate |
|---|---|
| PubChem CID | 56655292 |
| Molecular Formula | C19H16N2O8 |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [(Z,4R)-1-methoxy-5-nitro-4-(3-nitrophenyl)-1-oxopent-2-en-2-yl] benzoate |
| SMILES | COC(=O)/C(=C/[C@@H](C[N+](=O)[O-])c1cccc([N+](=O)[O-])c1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O8/c1-28-19(23)17(29-18(22)13-6-3-2-4-7-13)11-15(12-20(24)25)14-8-5-9-16(10-14)21(26)27/h2-11,15H,12H2,1H3/b17-11-/t15-/m0/s1 |
| InChIKey | GSMUOEMRBWSXER-ZCQLHAAUSA-N |
| XLogP | 2.87 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|