C19H17NO6 — CID 53467894
[(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] benzoate (PubChem CID 53467894) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] benzoate.
| Compound Name | [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] benzoate |
|---|---|
| PubChem CID | 53467894 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] benzoate |
| SMILES | COC(=O)/C(=C/[C@@H](C[N+](=O)[O-])c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17NO6/c1-25-19(22)17(26-18(21)15-10-6-3-7-11-15)12-16(13-20(23)24)14-8-4-2-5-9-14/h2-12,16H,13H2,1H3/b17-12-/t16-/m0/s1 |
| InChIKey | DAIIQTKXHWPIQM-BQGMYUGNSA-N |
| XLogP | 2.96 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|