About [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate
[(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate (PubChem CID 53468118) has the molecular formula C19H16BrNO6
and a molecular weight of 434.24 g/mol. Its IUPAC name is [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate.
Molecular Properties
| Compound Name | [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate |
| PubChem CID | 53468118 |
| Molecular Formula | C19H16BrNO6 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate |
| SMILES | COC(=O)/C(=C/[C@@H](C[N+](=O)[O-])c1ccccc1)OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H16BrNO6/c1-26-19(23)17(27-18(22)14-7-9-16(20)10-8-14)11-15(12-21(24)25)13-5-3-2-4-6-13/h2-11,15H,12H2,1H3/b17-11-/t15-/m0/s1 |
| InChIKey | FVJAOFDEWGUOLX-ZCQLHAAUSA-N |
| XLogP | 3.72 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate?
The IUPAC name of [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate (CID 53468118) is [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate.
What is the SMILES notation for [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate?
The canonical SMILES for [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate is COC(=O)/C(=C/[C@@H](C[N+](=O)[O-])c1ccccc1)OC(=O)c1ccc(Br)cc1.
What is the InChIKey of [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate?
The InChIKey is FVJAOFDEWGUOLX-ZCQLHAAUSA-N. The full InChI is InChI=1S/C19H16BrNO6/c1-26-19(23)17(27-18(22)14-7-9-16(20)10-8-14)11-15(12-21(24)25)13-5-3-2-4-6-13/h2-11,15H,12H2,1H3/b17-11-/t15-/m0/s1.
What are the key properties of [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate?
[(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate has a molecular weight of 434.24 g/mol, XLogP of 3.72, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,4R)-1-methoxy-5-nitro-1-oxo-4-phenylpent-2-en-2-yl] 4-bromobenzoate is sourced from PubChem (CID 53468118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).