C25H38N4O6 — CID 56662797
[(4R,5S)-2-oxo-4-[(4-phenylpiperazin-1-yl)methyl]-1,3-oxazolidin-5-yl]methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 56662797) has the molecular formula C25H38N4O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is [(4R,5S)-2-oxo-4-[(4-phenylpiperazin-1-yl)methyl]-1,3-oxazolidin-5-yl]methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | [(4R,5S)-2-oxo-4-[(4-phenylpiperazin-1-yl)methyl]-1,3-oxazolidin-5-yl]methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 56662797 |
| Molecular Formula | C25H38N4O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | [(4R,5S)-2-oxo-4-[(4-phenylpiperazin-1-yl)methyl]-1,3-oxazolidin-5-yl]methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(=O)OC[C@H]1OC(=O)N[C@@H]1CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H38N4O6/c1-25(2,3)35-23(31)26-12-8-7-11-22(30)33-18-21-20(27-24(32)34-21)17-28-13-15-29(16-14-28)19-9-5-4-6-10-19/h4-6,9-10,20-21H,7-8,11-18H2,1-3H3,(H,26,31)(H,27,32)/t20-,21-/m1/s1 |
| InChIKey | RALGLIGUHYAMKN-NHCUHLMSSA-N |
| XLogP | 2.52 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|