C22H25N5O6 — CID 56669588
[(4R,5S)-2-oxo-4-[(4-phenylpiperazin-1-yl)methyl]-1,3-oxazolidin-5-yl]methyl N-(4-nitrophenyl)carbamate (PubChem CID 56669588) has the molecular formula C22H25N5O6 and a molecular weight of 455.47 g/mol. Its IUPAC name is [(4R,5S)-2-oxo-4-[(4-phenylpiperazin-1-yl)methyl]-1,3-oxazolidin-5-yl]methyl N-(4-nitrophenyl)carbamate.
| Compound Name | [(4R,5S)-2-oxo-4-[(4-phenylpiperazin-1-yl)methyl]-1,3-oxazolidin-5-yl]methyl N-(4-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 56669588 |
| Molecular Formula | C22H25N5O6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | [(4R,5S)-2-oxo-4-[(4-phenylpiperazin-1-yl)methyl]-1,3-oxazolidin-5-yl]methyl N-(4-nitrophenyl)carbamate |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)OC[C@H]1OC(=O)N[C@@H]1CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H25N5O6/c28-21(23-16-6-8-18(9-7-16)27(30)31)32-15-20-19(24-22(29)33-20)14-25-10-12-26(13-11-25)17-4-2-1-3-5-17/h1-9,19-20H,10-15H2,(H,23,28)(H,24,29)/t19-,20-/m1/s1 |
| InChIKey | WFZFTJJOKFQZKB-WOJBJXKFSA-N |
| XLogP | 2.44 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|