C27H28N6O3S — CID 56663289
N-[5-[3-(benzenesulfonamido)phenyl]-1H-pyrazol-3-yl]-3-(4-methylpiperazin-1-yl)benzamide (PubChem CID 56663289) has the molecular formula C27H28N6O3S and a molecular weight of 516.63 g/mol. Its IUPAC name is N-[5-[3-(benzenesulfonamido)phenyl]-1H-pyrazol-3-yl]-3-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[5-[3-(benzenesulfonamido)phenyl]-1H-pyrazol-3-yl]-3-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 56663289 |
| Molecular Formula | C27H28N6O3S |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | N-[5-[3-(benzenesulfonamido)phenyl]-1H-pyrazol-3-yl]-3-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2cccc(C(=O)Nc3cc(-c4cccc(NS(=O)(=O)c5ccccc5)c4)[nH]n3)c2)CC1 |
| InChI | InChI=1S/C27H28N6O3S/c1-32-13-15-33(16-14-32)23-10-6-8-21(18-23)27(34)28-26-19-25(29-30-26)20-7-5-9-22(17-20)31-37(35,36)24-11-3-2-4-12-24/h2-12,17-19,31H,13-16H2,1H3,(H2,28,29,30,34) |
| InChIKey | YEWDZQBQOJUCOS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |