C17H15NO2S — CID 56671908
4-phenyl-1-(2-sulfanylidene-1,3-benzoxazol-3-yl)butan-1-one (PubChem CID 56671908) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-phenyl-1-(2-sulfanylidene-1,3-benzoxazol-3-yl)butan-1-one.
| Compound Name | 4-phenyl-1-(2-sulfanylidene-1,3-benzoxazol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 56671908 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 4-phenyl-1-(2-sulfanylidene-1,3-benzoxazol-3-yl)butan-1-one |
| SMILES | O=C(CCCc1ccccc1)n1c(=S)oc2ccccc21 |
| InChI | InChI=1S/C17H15NO2S/c19-16(12-6-9-13-7-2-1-3-8-13)18-14-10-4-5-11-15(14)20-17(18)21/h1-5,7-8,10-11H,6,9,12H2 |
| InChIKey | RNYAXQPKKCKWFE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|